Products 99065-80-2

CAS 99065-80-2 is the registry number for Methyl 1-(2-hydroxyethyl)piperidine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 1-(2-hydroxyethyl)piperidine-4-carboxylate (CAS 99065-80-2) is a chemical compound with the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. IUPAC name: methyl 1-(2-hydroxyethyl)piperidine-4-carboxylate. InChIKey: LBMXGNXYBMWVRQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17NO3
Molecular weight187.24 g/mol
IUPAC namemethyl 1-(2-hydroxyethyl)piperidine-4-carboxylate
InChIKeyLBMXGNXYBMWVRQ-UHFFFAOYSA-N
SMILESCOC(=O)C1CCN(CC1)CCO

Computed by PubChem (NCBI)