CAS 99071-38-2 is the registry number for 4-Iodo-3-methyl-1-phenyl-1H-pyrazol-5-amine. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
4-iodo-3-methyl-1-phenylpyrazol-5-amine (CAS 99071-38-2) is a chemical compound with the molecular formula C10H10IN3 and a molecular weight of 299.11 g/mol. IUPAC name: 4-iodo-3-methyl-1-phenylpyrazol-5-amine. InChIKey: PCHBEBCDMAJLLU-UHFFFAOYSA-N.
| Molecular formula | C10H10IN3 |
|---|---|
| Molecular weight | 299.11 g/mol |
| IUPAC name | 4-iodo-3-methyl-1-phenylpyrazol-5-amine |
| InChIKey | PCHBEBCDMAJLLU-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1I)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)