Products 99099-78-2
CAS 99099-78-2 is the registry number for 4-((4-Methylbenzenesulfonyl)oxy)-1-(2-phenyl-2H-1,2,3-triazol-4-yl)butane-1,2,3-triol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[2,3,4-trihydroxy-4-(2-phenyltriazol-4-yl)butyl] 4-methylbenzenesulfonate (CAS 99099-78-2) is a chemical compound with the molecular formula C19H21N3O6S and a molecular weight of 419.5 g/mol. IUPAC name: [2,3,4-trihydroxy-4-(2-phenyltriazol-4-yl)butyl] 4-methylbenzenesulfonate. InChIKey: WHXCEDUFWVSHQA-UHFFFAOYSA-N.
| Molecular formula | C19H21N3O6S |
|---|---|
| Molecular weight | 419.5 g/mol |
| IUPAC name | [2,3,4-trihydroxy-4-(2-phenyltriazol-4-yl)butyl] 4-methylbenzenesulfonate |
| InChIKey | WHXCEDUFWVSHQA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(C(C(C2=NN(N=C2)C3=CC=CC=C3)O)O)O |
Computed by PubChem (NCBI)