CAS 99112-94-4 appears in our catalog under these names: (S)-2-Benzylpiperidine, 95%, (S)-2-Benzylpiperidine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g.
(2S)-2-benzylpiperidine (CAS 99112-94-4) is a chemical compound with the molecular formula C12H17N and a molecular weight of 175.27 g/mol. IUPAC name: (2S)-2-benzylpiperidine. InChIKey: ITXCORRITGNIHP-LBPRGKRZSA-N.
| Molecular formula | C12H17N |
|---|---|
| Molecular weight | 175.27 g/mol |
| IUPAC name | (2S)-2-benzylpiperidine |
| InChIKey | ITXCORRITGNIHP-LBPRGKRZSA-N |
| SMILES | C1CCN[C@@H](C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)