Products 99116-16-2

CAS 99116-16-2 is the registry number for 3-(Propane-1-sulfonyl)-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-propylsulfonylpropanoic acid (CAS 99116-16-2) is a chemical compound with the molecular formula C6H12O4S and a molecular weight of 180.22 g/mol. IUPAC name: 3-propylsulfonylpropanoic acid. InChIKey: MVRIMOMHOJBOKT-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12O4S
Molecular weight180.22 g/mol
IUPAC name3-propylsulfonylpropanoic acid
InChIKeyMVRIMOMHOJBOKT-UHFFFAOYSA-N
SMILESCCCS(=O)(=O)CCC(=O)O

Computed by PubChem (NCBI)