CAS 99129-21-2 appears in our catalog under these names: Clethodim, Clethodim, >95% (HPLC), CLETHODIM, PESTANAL, MIXTURE OF ISOMERS, Clethodim, 95.0%, Clethodim (Standard). Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 5mg.
2-[N-[(E)-3-chloroprop-2-enoxy]-C-ethylcarbonimidoyl]-5-(2-ethylsulfanylpropyl)-3-hydroxycyclohex-2-en-1-one (CAS 99129-21-2) is a chemical compound with the molecular formula C17H26ClNO3S and a molecular weight of 359.9 g/mol. IUPAC name: 2-[N-[(E)-3-chloroprop-2-enoxy]-C-ethylcarbonimidoyl]-5-(2-ethylsulfanylpropyl)-3-hydroxycyclohex-2-en-1-one. InChIKey: SILSDTWXNBZOGF-JWGBMQLESA-N.
| Molecular formula | C17H26ClNO3S |
|---|---|
| Molecular weight | 359.9 g/mol |
| IUPAC name | 2-[N-[(E)-3-chloroprop-2-enoxy]-C-ethylcarbonimidoyl]-5-(2-ethylsulfanylpropyl)-3-hydroxycyclohex-2-en-1-one |
| InChIKey | SILSDTWXNBZOGF-JWGBMQLESA-N |
| SMILES | CCC(=NOC/C=C/Cl)C1=C(CC(CC1=O)CC(C)SCC)O |
Computed by PubChem (NCBI)