Products 99189-60-3
CAS 99189-60-3 appears in our catalog under these names: Gabapentin Impurity 5, 1,1-Cyclohexanediacetic Acid Monoamide, >95% (HPLC), 1,1-Cyclohexanediacetic Acid Monoamide, 1,1–Cyclohexanediacetic acid monoamide, 1-(Carbamoylmethyl)cyclohexaneacetic Acid, >98.0%(T). Offered by: Chemat Brand, TRC, Mikromol, GLPBio, TCI. Available pack sizes: on request, 10g, 25g, 5g, 25mg, 100g, 500g, 100 g.
2-[1-(2-amino-2-oxoethyl)cyclohexyl]acetic acid (CAS 99189-60-3) is a chemical compound with the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. IUPAC name: 2-[1-(2-amino-2-oxoethyl)cyclohexyl]acetic acid. InChIKey: QJGSJXLCJRXTRY-UHFFFAOYSA-N.
| Molecular formula | C10H17NO3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 2-[1-(2-amino-2-oxoethyl)cyclohexyl]acetic acid |
| InChIKey | QJGSJXLCJRXTRY-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(CC(=O)N)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1,1-Cyclohexanediacetic acid monoamide, 2-(1-(2-amino-2-oxoethyl)cyclohexyl)acetic acid, 2-[1-(2-amino-2-oxoethyl)cyclohexyl]acetic acid, Cyclohexaneacetic acid, 1-(2-amino-2-oxoethyl)-, [1-(2-amino-2-oxoethyl)cyclohexyl]acetic acid, 3,3-Pentamethyleneglutaramic acid, 2-[(carbamoylmethyl)cyclohexyl]acetic acid, 1-(Carbamoylmethyl)cyclohexaneacetic Acid, 1-(2-Amino-2-oxoethyl)cyclohexaneacetic acid, 2-[1-(carbamoylmethyl)cyclohexyl]acetic acid