CAS 99276-81-0 is the registry number for 4,4'-((4-(tert-Butyl)-1,2-phenylene)bis(oxy))diphthalonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-tert-butyl-2-(3,4-dicyanophenoxy)phenoxy]benzene-1,2-dicarbonitrile (CAS 99276-81-0) is a chemical compound with the molecular formula C26H18N4O2 and a molecular weight of 418.4 g/mol. IUPAC name: 4-[4-tert-butyl-2-(3,4-dicyanophenoxy)phenoxy]benzene-1,2-dicarbonitrile. InChIKey: ZATJTKAGCWLZOY-UHFFFAOYSA-N.
| Molecular formula | C26H18N4O2 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | 4-[4-tert-butyl-2-(3,4-dicyanophenoxy)phenoxy]benzene-1,2-dicarbonitrile |
| InChIKey | ZATJTKAGCWLZOY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)OC2=CC(=C(C=C2)C#N)C#N)OC3=CC(=C(C=C3)C#N)C#N |
Computed by PubChem (NCBI)