Products 99287-12-4

CAS 99287-12-4 is the registry number for Metaphit Methanesulfonate Salt. Offered by: TRC. Available pack sizes: 250mg, 25mg.

Structural formula: {0} (CAS {1})

1-[1-(3-isothiocyanatophenyl)cyclohexyl]piperidine;methanesulfonic acid (CAS 99287-12-4) is a chemical compound with the molecular formula C19H28N2O3S2 and a molecular weight of 396.6 g/mol. IUPAC name: 1-[1-(3-isothiocyanatophenyl)cyclohexyl]piperidine;methanesulfonic acid. InChIKey: ZASHKPXYYPYQRI-UHFFFAOYSA-N.

Identity
Molecular formulaC19H28N2O3S2
Molecular weight396.6 g/mol
IUPAC name1-[1-(3-isothiocyanatophenyl)cyclohexyl]piperidine;methanesulfonic acid
InChIKeyZASHKPXYYPYQRI-UHFFFAOYSA-N
SMILESCS(=O)(=O)O.C1CCC(CC1)(C2=CC(=CC=C2)N=C=S)N3CCCCC3

Computed by PubChem (NCBI)