Products 99330-28-6
CAS 99330-28-6 is the registry number for Antibacterial agent 116. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[5-(4-chlorobenzoyl)-2-(4-chlorophenoxy)phenyl]-2-hydroxy-3,5-diiodobenzamide (CAS 99330-28-6) is a chemical compound with the molecular formula C26H15Cl2I2NO4 and a molecular weight of 730.1 g/mol. IUPAC name: N-[5-(4-chlorobenzoyl)-2-(4-chlorophenoxy)phenyl]-2-hydroxy-3,5-diiodobenzamide. InChIKey: LXHTXRZCFIWDPF-UHFFFAOYSA-N.
| Molecular formula | C26H15Cl2I2NO4 |
|---|---|
| Molecular weight | 730.1 g/mol |
| IUPAC name | N-[5-(4-chlorobenzoyl)-2-(4-chlorophenoxy)phenyl]-2-hydroxy-3,5-diiodobenzamide |
| InChIKey | LXHTXRZCFIWDPF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC(=C(C=C2)OC3=CC=C(C=C3)Cl)NC(=O)C4=C(C(=CC(=C4)I)I)O)Cl |
Computed by PubChem (NCBI)