Products 99330-32-2

CAS 99330-32-2 is the registry number for Otilonium Bromide Impurity 15. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[4-[(2-decoxybenzoyl)amino]benzoyl]oxyethyl-diethyl-methylazanium bromide (CAS 99330-32-2) is a chemical compound with the molecular formula C31H47BrN2O4 and a molecular weight of 591.6 g/mol. IUPAC name: 2-[4-[(2-decoxybenzoyl)amino]benzoyl]oxyethyl-diethyl-methylazanium bromide. InChIKey: AIDGIPJIMMYHAJ-UHFFFAOYSA-N.

Identity
Molecular formulaC31H47BrN2O4
Molecular weight591.6 g/mol
IUPAC name2-[4-[(2-decoxybenzoyl)amino]benzoyl]oxyethyl-diethyl-methylazanium bromide
InChIKeyAIDGIPJIMMYHAJ-UHFFFAOYSA-N
SMILESCCCCCCCCCCOC1=CC=CC=C1C(=O)NC2=CC=C(C=C2)C(=O)OCC[N+](C)(CC)CC.[Br-]

Computed by PubChem (NCBI)