Products 99357-25-2

CAS 99357-25-2 is the registry number for 2,4-Dimethyl-thiazole-5-carboxylic acid hydrazide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

2,4-dimethyl-1,3-thiazole-5-carbohydrazide (CAS 99357-25-2) is a chemical compound with the molecular formula C6H9N3OS and a molecular weight of 171.22 g/mol. IUPAC name: 2,4-dimethyl-1,3-thiazole-5-carbohydrazide. InChIKey: WHGDPVYDXLQXON-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9N3OS
Molecular weight171.22 g/mol
IUPAC name2,4-dimethyl-1,3-thiazole-5-carbohydrazide
InChIKeyWHGDPVYDXLQXON-UHFFFAOYSA-N
SMILESCC1=C(SC(=N1)C)C(=O)NN

Computed by PubChem (NCBI)