CAS 99367-63-2 is the registry number for 5-(5-Phenyl-1,3,4-oxadiazol-2-yl)-1,3,4-oxadiazol-2-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-(5-phenyl-1,3,4-oxadiazol-2-yl)-1,3,4-oxadiazol-2-amine (CAS 99367-63-2) is a chemical compound with the molecular formula C10H7N5O2 and a molecular weight of 229.19 g/mol. IUPAC name: 5-(5-phenyl-1,3,4-oxadiazol-2-yl)-1,3,4-oxadiazol-2-amine. InChIKey: PSFDQYCVZZJBBC-UHFFFAOYSA-N.
| Molecular formula | C10H7N5O2 |
|---|---|
| Molecular weight | 229.19 g/mol |
| IUPAC name | 5-(5-phenyl-1,3,4-oxadiazol-2-yl)-1,3,4-oxadiazol-2-amine |
| InChIKey | PSFDQYCVZZJBBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(O2)C3=NN=C(O3)N |
Computed by PubChem (NCBI)