CAS 99433-28-0 appears in our catalog under these names: 2-Bromo-1-(4-cyclohexylphenyl)ethanone, 98%, 2-Bromo-1-(4-cyclohexylphenyl)ethanone, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
2-bromo-1-(4-cyclohexylphenyl)ethanone (CAS 99433-28-0) is a chemical compound with the molecular formula C14H17BrO and a molecular weight of 281.19 g/mol. IUPAC name: 2-bromo-1-(4-cyclohexylphenyl)ethanone. InChIKey: JMCBGXFQNHCVBY-UHFFFAOYSA-N.
| Molecular formula | C14H17BrO |
|---|---|
| Molecular weight | 281.19 g/mol |
| IUPAC name | 2-bromo-1-(4-cyclohexylphenyl)ethanone |
| InChIKey | JMCBGXFQNHCVBY-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=CC=C(C=C2)C(=O)CBr |
Computed by PubChem (NCBI)