Products 99492-83-8
CAS 99492-83-8 appears in our catalog under these names: Uridine Diphosphate Choline (UDPC), Uridine 5'-diphosphate choline ammonium, Uridine 5'-diphosphate choline ammonium, 1 mg, Uridine 5'-diphosphate choline ammonium, 2 mg, Uridine 5'-diphosphate choline ammonium, 5 mg. Offered by: Chemat Brand, Biosynth, Roth. Available pack sizes: on request, 2mg, 1mg, 5mg, 10mg, 25mg.
[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;2-hydroxyethyl(trimethyl)azanium (CAS 99492-83-8) is a chemical compound with the molecular formula C14H28N3O13P2+ and a molecular weight of 508.33 g/mol. IUPAC name: [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;2-hydroxyethyl(trimethyl)azanium. InChIKey: QXRGZHKAEBNXGI-IAIGYFSYSA-N.
| Molecular formula | C14H28N3O13P2+ |
|---|---|
| Molecular weight | 508.33 g/mol |
| IUPAC name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;2-hydroxyethyl(trimethyl)azanium |
| InChIKey | QXRGZHKAEBNXGI-IAIGYFSYSA-N |
| SMILES | C[N+](C)(C)CCO.C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)(O)OP(=O)(O)O)O)O |
Computed by PubChem (NCBI)