Products 995-33-5

CAS 995-33-5 is the registry number for Butyl 4,4'-bis(tert-butylperoxy)valerate (Technical Grade). Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.

Structural formula: {0} (CAS {1})

Butyl 4,4-bis(tert-butylperoxy)pentanoate (CAS 995-33-5) is a chemical compound with the molecular formula C17H34O6 and a molecular weight of 334.4 g/mol. IUPAC name: butyl 4,4-bis(tert-butylperoxy)pentanoate. InChIKey: BXIQXYOPGBXIEM-UHFFFAOYSA-N.

Identity
Molecular formulaC17H34O6
Molecular weight334.4 g/mol
IUPAC namebutyl 4,4-bis(tert-butylperoxy)pentanoate
InChIKeyBXIQXYOPGBXIEM-UHFFFAOYSA-N
SMILESCCCCOC(=O)CCC(C)(OOC(C)(C)C)OOC(C)(C)C

Computed by PubChem (NCBI)