CAS 99508-26-6 is the registry number for Carboxyamidotriazole Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
[4-(azidomethyl)-2,6-dichlorophenyl]-(4-chlorophenyl)methanone (CAS 99508-26-6) is a chemical compound with the molecular formula C14H8Cl3N3O and a molecular weight of 340.6 g/mol. IUPAC name: [4-(azidomethyl)-2,6-dichlorophenyl]-(4-chlorophenyl)methanone. InChIKey: FLISRKMOMNUNEF-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl3N3O |
|---|---|
| Molecular weight | 340.6 g/mol |
| IUPAC name | [4-(azidomethyl)-2,6-dichlorophenyl]-(4-chlorophenyl)methanone |
| InChIKey | FLISRKMOMNUNEF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(C=C(C=C2Cl)CN=[N+]=[N-])Cl)Cl |
Computed by PubChem (NCBI)