CAS 99528-42-4 appears in our catalog under these names: (S)–1–(4–Chlorophenyl)ethanol, (S)-1-(4-Chlorophenyl)ethanol, 97%, (S)-4-Chloro-alpha-methylbenzyl alcohol, (S)-1-(4-Chlorophenyl)ethanol 97%, (S)-4-CHLORO-ALPHA-METHYLBENZYL ALCOHOL,. Offered by: GLPBio, Combi-blocks, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100mg.
(1S)-1-(4-chlorophenyl)ethanol (CAS 99528-42-4) is a chemical compound with the molecular formula C8H9ClO and a molecular weight of 156.61 g/mol. IUPAC name: (1S)-1-(4-chlorophenyl)ethanol. InChIKey: MVOSNPUNXINWAD-LURJTMIESA-N.
| Molecular formula | C8H9ClO |
|---|---|
| Molecular weight | 156.61 g/mol |
| IUPAC name | (1S)-1-(4-chlorophenyl)ethanol |
| InChIKey | MVOSNPUNXINWAD-LURJTMIESA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)Cl)O |
Computed by PubChem (NCBI)