CAS 996-23-6 appears in our catalog under these names: Glycolic acid calcium salt, 95%, Calcium Glycolate, Calcium glycolate, Calcium Glycolate, >97.0%(T), Glycolic Acid Calcium Salt. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 25g, 1g, 5g, 50g, 100g, 250g.
Calcium bis(2-hydroxyacetate) (CAS 996-23-6) is a chemical compound with the molecular formula C4H6CaO6 and a molecular weight of 190.16 g/mol. IUPAC name: calcium bis(2-hydroxyacetate). InChIKey: CHRHZFQUDFAQEQ-UHFFFAOYSA-L.
| Molecular formula | C4H6CaO6 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | calcium bis(2-hydroxyacetate) |
| InChIKey | CHRHZFQUDFAQEQ-UHFFFAOYSA-L |
| SMILES | C(C(=O)[O-])O.C(C(=O)[O-])O.[Ca+2] |
Computed by PubChem (NCBI)