CAS 99610-72-7 is the registry number for 2-((2-hydroxyethyl)amino)-4,6-dinitrophenol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
2-(2-hydroxyethylamino)-4,6-dinitrophenol (CAS 99610-72-7) is a chemical compound with the molecular formula C8H9N3O6 and a molecular weight of 243.17 g/mol. IUPAC name: 2-(2-hydroxyethylamino)-4,6-dinitrophenol. InChIKey: OABRBVCUJIJMOB-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O6 |
|---|---|
| Molecular weight | 243.17 g/mol |
| IUPAC name | 2-(2-hydroxyethylamino)-4,6-dinitrophenol |
| InChIKey | OABRBVCUJIJMOB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1NCCO)O)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)