Products 99615-00-6
CAS 99615-00-6 is the registry number for Leucanthogenin. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(3,4-dihydroxyphenyl)-5,8-dihydroxy-6,7-dimethoxychromen-4-one (CAS 99615-00-6) is a chemical compound with the molecular formula C17H14O8 and a molecular weight of 346.3 g/mol. IUPAC name: 2-(3,4-dihydroxyphenyl)-5,8-dihydroxy-6,7-dimethoxychromen-4-one. InChIKey: VZNIMRVJHRTTKA-UHFFFAOYSA-N.
| Molecular formula | C17H14O8 |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | 2-(3,4-dihydroxyphenyl)-5,8-dihydroxy-6,7-dimethoxychromen-4-one |
| InChIKey | VZNIMRVJHRTTKA-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1O)C(=O)C=C(O2)C3=CC(=C(C=C3)O)O)O)OC |
Computed by PubChem (NCBI)