CAS 99696-21-6 is the registry number for Sitafloxacin Impurity 58. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 8-chloro-1-cyclopropyl-6,7-difluoro-4-oxoquinoline-3-carboxylate (CAS 99696-21-6) is a chemical compound with the molecular formula C15H12ClF2NO3 and a molecular weight of 327.71 g/mol. IUPAC name: ethyl 8-chloro-1-cyclopropyl-6,7-difluoro-4-oxoquinoline-3-carboxylate. InChIKey: NUBFPWXUKJGZNA-UHFFFAOYSA-N.
| Molecular formula | C15H12ClF2NO3 |
|---|---|
| Molecular weight | 327.71 g/mol |
| IUPAC name | ethyl 8-chloro-1-cyclopropyl-6,7-difluoro-4-oxoquinoline-3-carboxylate |
| InChIKey | NUBFPWXUKJGZNA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN(C2=C(C(=C(C=C2C1=O)F)F)Cl)C3CC3 |
Computed by PubChem (NCBI)