CAS 997-43-3 appears in our catalog under these names: Potassium hydrogen 2-oxoglutarate, 95%, Potassium hydrogen 2–oxoglutarate, 2-Ketoglutaric acid monopotassium salt, 99.00%, α-Ketoglutaric acid potassium, alpha-Ketoglutaric acid potassium salt, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Biosynth, Thermo Scientific (Acros). Available pack sizes: 5g, 1g, 100g, 25g, 250g, 0,1kg, 0,25kg, 0,5kg.
Potassium 5-hydroxy-2,5-dioxopentanoate (CAS 997-43-3) is a chemical compound with the molecular formula C5H5KO5 and a molecular weight of 184.19 g/mol. IUPAC name: potassium 5-hydroxy-2,5-dioxopentanoate. InChIKey: XTCZBVVKDHLWKU-UHFFFAOYSA-M.
| Molecular formula | C5H5KO5 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | potassium 5-hydroxy-2,5-dioxopentanoate |
| InChIKey | XTCZBVVKDHLWKU-UHFFFAOYSA-M |
| SMILES | C(CC(=O)O)C(=O)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)