CAS 99726-76-8 is the registry number for Lomefloxacin Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
1-ethyl-6,8-difluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid (CAS 99726-76-8) is a chemical compound with the molecular formula C16H17F2N3O3 and a molecular weight of 337.32 g/mol. IUPAC name: 1-ethyl-6,8-difluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid. InChIKey: YHRXPOLYCUTZAM-UHFFFAOYSA-N.
| Molecular formula | C16H17F2N3O3 |
|---|---|
| Molecular weight | 337.32 g/mol |
| IUPAC name | 1-ethyl-6,8-difluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid |
| InChIKey | YHRXPOLYCUTZAM-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=CC(=C(C(=C21)F)N3CCNCC3)F)C(=O)O |
Computed by PubChem (NCBI)