Products 99726-76-8

CAS 99726-76-8 is the registry number for Lomefloxacin Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-ethyl-6,8-difluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid (CAS 99726-76-8) is a chemical compound with the molecular formula C16H17F2N3O3 and a molecular weight of 337.32 g/mol. IUPAC name: 1-ethyl-6,8-difluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid. InChIKey: YHRXPOLYCUTZAM-UHFFFAOYSA-N.

Identity
Molecular formulaC16H17F2N3O3
Molecular weight337.32 g/mol
IUPAC name1-ethyl-6,8-difluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid
InChIKeyYHRXPOLYCUTZAM-UHFFFAOYSA-N
SMILESCCN1C=C(C(=O)C2=CC(=C(C(=C21)F)N3CCNCC3)F)C(=O)O

Computed by PubChem (NCBI)