CAS 99822-90-9 is the registry number for 3-((4-Fluorophenyl)amino)-4-nitropyridine 1-oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-fluorophenyl)-4-nitro-1-oxidopyridin-1-ium-3-amine (CAS 99822-90-9) is a chemical compound with the molecular formula C11H8FN3O3 and a molecular weight of 249.20 g/mol. IUPAC name: N-(4-fluorophenyl)-4-nitro-1-oxidopyridin-1-ium-3-amine. InChIKey: URCTUTMZCTWEHB-UHFFFAOYSA-N.
| Molecular formula | C11H8FN3O3 |
|---|---|
| Molecular weight | 249.20 g/mol |
| IUPAC name | N-(4-fluorophenyl)-4-nitro-1-oxidopyridin-1-ium-3-amine |
| InChIKey | URCTUTMZCTWEHB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=C(C=C[N+](=C2)[O-])[N+](=O)[O-])F |
Computed by PubChem (NCBI)