CAS 99832-61-8 is the registry number for RH 3421. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 5-(4-chlorophenyl)-4-methyl-2-[[4-(trifluoromethyl)phenyl]carbamoyl]-3H-pyrazole-4-carboxylate (CAS 99832-61-8) is a chemical compound with the molecular formula C20H17ClF3N3O3 and a molecular weight of 439.8 g/mol. IUPAC name: methyl 5-(4-chlorophenyl)-4-methyl-2-[[4-(trifluoromethyl)phenyl]carbamoyl]-3H-pyrazole-4-carboxylate. InChIKey: NWYXCHPAIGQKNN-UHFFFAOYSA-N.
| Molecular formula | C20H17ClF3N3O3 |
|---|---|
| Molecular weight | 439.8 g/mol |
| IUPAC name | methyl 5-(4-chlorophenyl)-4-methyl-2-[[4-(trifluoromethyl)phenyl]carbamoyl]-3H-pyrazole-4-carboxylate |
| InChIKey | NWYXCHPAIGQKNN-UHFFFAOYSA-N |
| SMILES | CC1(CN(N=C1C2=CC=C(C=C2)Cl)C(=O)NC3=CC=C(C=C3)C(F)(F)F)C(=O)OC |
Computed by PubChem (NCBI)