CAS 99860-35-2 is the registry number for 6-(1-Chloroethyl)-4-(phenylimino)-1,4-dihydro-1,3,5-triazin-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
6-(1-chloroethyl)-2-N-phenyl-1,3,5-triazine-2,4-diamine (CAS 99860-35-2) is a chemical compound with the molecular formula C11H12ClN5 and a molecular weight of 249.70 g/mol. IUPAC name: 6-(1-chloroethyl)-2-N-phenyl-1,3,5-triazine-2,4-diamine. InChIKey: HSOZFTGYXPQTLE-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN5 |
|---|---|
| Molecular weight | 249.70 g/mol |
| IUPAC name | 6-(1-chloroethyl)-2-N-phenyl-1,3,5-triazine-2,4-diamine |
| InChIKey | HSOZFTGYXPQTLE-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=NC(=N1)NC2=CC=CC=C2)N)Cl |
Computed by PubChem (NCBI)