Products 99863-59-9

CAS 99863-59-9 appears in our catalog under these names: Leucine, 2-(2-methylpropyl)-, 98%, 98%, 2-Amino-2-isobutyl-4-methylpentanoic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-amino-4-methyl-2-(2-methylpropyl)pentanoic acid (CAS 99863-59-9) is a chemical compound with the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. IUPAC name: 2-amino-4-methyl-2-(2-methylpropyl)pentanoic acid. InChIKey: NHHUZNBRAXROKE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H21NO2
Molecular weight187.28 g/mol
IUPAC name2-amino-4-methyl-2-(2-methylpropyl)pentanoic acid
InChIKeyNHHUZNBRAXROKE-UHFFFAOYSA-N
SMILESCC(C)CC(CC(C)C)(C(=O)O)N

Computed by PubChem (NCBI)