Products 99946-04-0
CAS 99946-04-0 is the registry number for Isoboonein. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4aR,6S,7R,7aS)-6-hydroxy-7-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran-3-one (CAS 99946-04-0) is a chemical compound with the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. IUPAC name: (4aR,6S,7R,7aS)-6-hydroxy-7-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran-3-one. InChIKey: DPDXVBIWZBJGSX-XUTVFYLZSA-N.
| Molecular formula | C9H14O3 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | (4aR,6S,7R,7aS)-6-hydroxy-7-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran-3-one |
| InChIKey | DPDXVBIWZBJGSX-XUTVFYLZSA-N |
| SMILES | C[C@H]1[C@H](C[C@H]2[C@@H]1COC(=O)C2)O |
Computed by PubChem (NCBI)