Products 99965-82-9

CAS 99965-82-9 is the registry number for 6-(Phenylthio)hexan-1-ol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

6-phenylsulfanylhexan-1-ol (CAS 99965-82-9) is a chemical compound with the molecular formula C12H18OS and a molecular weight of 210.34 g/mol. IUPAC name: 6-phenylsulfanylhexan-1-ol. InChIKey: ZYELXJRSBFSECJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18OS
Molecular weight210.34 g/mol
IUPAC name6-phenylsulfanylhexan-1-ol
InChIKeyZYELXJRSBFSECJ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)SCCCCCCO

Computed by PubChem (NCBI)