cas: 7483-33-2 — see every product listed under this CAS number, including other names
quinoxaline-2-carbonitrile, ≥95%, ≥95% (CAS 7483-33-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114HXC-100mg |
| cas | 7483-33-2 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 664.40 Pln | |
| Chemat | 1g | 1725.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Quinoxaline-2-carbonitrile (CAS 7483-33-2) is a chemical compound with the molecular formula C9H5N3 and a molecular weight of 155.16 g/mol. IUPAC name: quinoxaline-2-carbonitrile. InChIKey: IVYZWJPQNNZOHV-UHFFFAOYSA-N.
| Molecular formula | C9H5N3 |
|---|---|
| Molecular weight | 155.16 g/mol |
| IUPAC name | quinoxaline-2-carbonitrile |
| InChIKey | IVYZWJPQNNZOHV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CC(=N2)C#N |
Computed by PubChem (NCBI)