cas: 500556-91-2 — see every product listed under this CAS number, including other names
rel-((1R,2S,4S)-7-(tert-Butoxycarbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid), 97% (CAS 500556-91-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F552125-100MG |
| cas | 500556-91-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 320.74 Pln | |
| Fluorochem | 250mg | 497.76 Pln | |
| Fluorochem | 1g | 966.34 Pln | |
| Fluorochem | 5g | 2986.47 Pln | |
| Fluorochem | 10g | 4902.46 Pln | |
| Fluorochem | 25g | 10015.24 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(1R,2S,4S)-7-[(2-methylpropan-2-yl)oxycarbonyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid (CAS 500556-91-2) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: (1R,2S,4S)-7-[(2-methylpropan-2-yl)oxycarbonyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: XRDRXGVDCVQVPV-XHNCKOQMSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | (1R,2S,4S)-7-[(2-methylpropan-2-yl)oxycarbonyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | XRDRXGVDCVQVPV-XHNCKOQMSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2CC[C@@H]1[C@H](C2)C(=O)O |
Computed by PubChem (NCBI)