CAS 2218441-58-6 appears in our catalog under these names: rel-(1R,3s,5S)-6,6-Difluorobicyclo[3.1.0]hexan-3-amine hydrochloride, 95%, 95%, rel-(1R,3s,5S)-6,6-Difluorobicyclo[3.1.0]hexan-3-amine hydrochloride, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 50mg.
(1S,5R)-6,6-difluorobicyclo[3.1.0]hexan-3-amine;hydrochloride (CAS 2218441-58-6) is a chemical compound with the molecular formula C6H10ClF2N and a molecular weight of 169.60 g/mol. IUPAC name: (1S,5R)-6,6-difluorobicyclo[3.1.0]hexan-3-amine;hydrochloride. InChIKey: DDXVVYHUUNFLFN-RSCCPHMWSA-N.
| Molecular formula | C6H10ClF2N |
|---|---|
| Molecular weight | 169.60 g/mol |
| IUPAC name | (1S,5R)-6,6-difluorobicyclo[3.1.0]hexan-3-amine;hydrochloride |
| InChIKey | DDXVVYHUUNFLFN-RSCCPHMWSA-N |
| SMILES | C1[C@@H]2[C@@H](C2(F)F)CC1N.Cl |
Computed by PubChem (NCBI)