cas: 374898-56-3 — see every product listed under this CAS number, including other names
rel-(1R,8S,9s,Z)-Bicyclo[6.1.0]non-4-en-9-ylmethanol 97% (CAS 374898-56-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1156576-50mg |
| cas | 374898-56-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 431.56 Pln | |
| Ambeed | 100mg | 676.31 Pln | |
| Ambeed | 250mg | 1138.00 Pln | |
| Ambeed | 1g | 2923.56 Pln | |
| Ambeed | 5g | 9687.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1156576 |
[(1R,4Z,8S)-9-bicyclo[6.1.0]non-4-enyl]methanol (CAS 374898-56-3) is a chemical compound with the molecular formula C10H16O and a molecular weight of 152.23 g/mol. IUPAC name: [(1R,4Z,8S)-9-bicyclo[6.1.0]non-4-enyl]methanol. InChIKey: NXQRWDARQUYASW-RLWGHQLRSA-N.
| Molecular formula | C10H16O |
|---|---|
| Molecular weight | 152.23 g/mol |
| IUPAC name | [(1R,4Z,8S)-9-bicyclo[6.1.0]non-4-enyl]methanol |
| InChIKey | NXQRWDARQUYASW-RLWGHQLRSA-N |
| SMILES | C/1C[C@@H]2[C@@H](C2CO)CC/C=C1 |
Computed by PubChem (NCBI)