cas: 374898-56-3 — see every product listed under this CAS number, including other names
rel-(1R,8S,9s,Z)-Bicyclo[6.1.0]non-4-en-9-ylmethanol, 97%, 97% (CAS 374898-56-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K6RX-50mg |
| cas | 374898-56-3 |
| size | 50mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 270.80 Pln | |
| Chemat | 100mg | 419.60 Pln | |
| Chemat | 250mg | 669.20 Pln | |
| Chemat | 1g | 1696.40 Pln | |
| Chemat | 5g | 5776.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[(1R,4Z,8S)-9-bicyclo[6.1.0]non-4-enyl]methanol (CAS 374898-56-3) is a chemical compound with the molecular formula C10H16O and a molecular weight of 152.23 g/mol. IUPAC name: [(1R,4Z,8S)-9-bicyclo[6.1.0]non-4-enyl]methanol. InChIKey: NXQRWDARQUYASW-RLWGHQLRSA-N.
| Molecular formula | C10H16O |
|---|---|
| Molecular weight | 152.23 g/mol |
| IUPAC name | [(1R,4Z,8S)-9-bicyclo[6.1.0]non-4-enyl]methanol |
| InChIKey | NXQRWDARQUYASW-RLWGHQLRSA-N |
| SMILES | C/1C[C@@H]2[C@@H](C2CO)CC/C=C1 |
Computed by PubChem (NCBI)