rel-(2R,2'S)-2,2'-Bipiperidine, 98%
cas: 18700-72-6 — see every product listed under this CAS number, including other names
rel-(2R,2'S)-2,2'-Bipiperidine, 98% (CAS 18700-72-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25mg, 50mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1352481-100mg |
| cas | 18700-72-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 631.81 Pln | |
| Ambeed | 1g | 1544.06 Pln | |
| Ambeed | 5g | 5977.38 Pln | |
| BLDpharm | 25mg | 247.72 Pln | |
| BLDpharm | 50mg | 314.36 Pln | |
| BLDpharm | 100mg | 425.43 Pln | |
| BLDpharm | 250mg | 675.34 Pln | |
| BLDpharm | 1g | 1663.88 Pln | |
| BLDpharm | 5g | 6439.98 Pln | |
| Chemat | 25mg | 208.40 Pln | |
| Chemat | 50mg | 275.60 Pln | |
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 578.00 Pln | |
| Chemat | 1g | 1456.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2R)-2-[(2S)-piperidin-2-yl]piperidine (CAS 18700-72-6) is a chemical compound with the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. IUPAC name: (2R)-2-[(2S)-piperidin-2-yl]piperidine. InChIKey: CLBJZAWCBRAMRZ-AOOOYVTPSA-N.
| Molecular formula | C10H20N2 |
|---|---|
| Molecular weight | 168.28 g/mol |
| IUPAC name | (2R)-2-[(2S)-piperidin-2-yl]piperidine |
| InChIKey | CLBJZAWCBRAMRZ-AOOOYVTPSA-N |
| SMILES | C1CCN[C@H](C1)[C@@H]2CCCCN2 |
Computed by PubChem (NCBI)