CAS 18700-72-6 appears in our catalog under these names: rel-(2R,2'S)-2,2'-Bipiperidine 98%, rel-(2R,2'S)-2,2'-Bipiperidine, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
(2R)-2-[(2S)-piperidin-2-yl]piperidine (CAS 18700-72-6) is a chemical compound with the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. IUPAC name: (2R)-2-[(2S)-piperidin-2-yl]piperidine. InChIKey: CLBJZAWCBRAMRZ-AOOOYVTPSA-N.
| Molecular formula | C10H20N2 |
|---|---|
| Molecular weight | 168.28 g/mol |
| IUPAC name | (2R)-2-[(2S)-piperidin-2-yl]piperidine |
| InChIKey | CLBJZAWCBRAMRZ-AOOOYVTPSA-N |
| SMILES | C1CCN[C@H](C1)[C@@H]2CCCCN2 |
Computed by PubChem (NCBI)