rel-(2R,3R)-3-(tert-Butyl)-4-(2,6-dimethoxyphenyl)-2-(2,4,6-triisopropylbenzyl)-2,3-dihydrobenzo[d][1,3]oxaphosphole, 98%
cas: 1908442-13-6 — see every product listed under this CAS number, including other names
rel-(2R,3R)-3-(tert-Butyl)-4-(2,6-dimethoxyphenyl)-2-(2,4,6-triisopropylbenzyl)-2,3-dihydrobenzo[d][1,3]oxaphosphole, 98% (CAS 1908442-13-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: BLDpharm, Chemat, Fluorochem.
| brand | BLDpharm |
|---|---|
| catalog number | BD01139692-50mg |
| cas | 1908442-13-6 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 50mg | 580.93 Pln | |
| BLDpharm | 100mg | 947.47 Pln | |
| BLDpharm | 250mg | 1480.61 Pln | |
| BLDpharm | 1g | 3718.72 Pln | |
| BLDpharm | 5g | 14653.75 Pln | |
| Chemat | 50mg | 443.60 Pln | |
| Chemat | 100mg | 520.40 Pln | |
| Chemat | 250mg | 1202.00 Pln | |
| Chemat | 1g | 3150.80 Pln | |
| Fluorochem | 50mg | 804.94 Pln | |
| Fluorochem | 100mg | 950.72 Pln | |
| Fluorochem | 250mg | 2231.52 Pln | |
| Fluorochem | 1g | 5850.04 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2R,3R)-3-tert-butyl-4-(2,6-dimethoxyphenyl)-2-[[2,4,6-tri(propan-2-yl)phenyl]methyl]-2H-1,3-benzoxaphosphole (CAS 1908442-13-6) is a chemical compound with the molecular formula C35H47O3P and a molecular weight of 546.7 g/mol. IUPAC name: (2R,3R)-3-tert-butyl-4-(2,6-dimethoxyphenyl)-2-[[2,4,6-tri(propan-2-yl)phenyl]methyl]-2H-1,3-benzoxaphosphole. InChIKey: RXGMKJPMNONITA-YSVKQWHRSA-N.
| Molecular formula | C35H47O3P |
|---|---|
| Molecular weight | 546.7 g/mol |
| IUPAC name | (2R,3R)-3-tert-butyl-4-(2,6-dimethoxyphenyl)-2-[[2,4,6-tri(propan-2-yl)phenyl]methyl]-2H-1,3-benzoxaphosphole |
| InChIKey | RXGMKJPMNONITA-YSVKQWHRSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)C[C@@H]2OC3=CC=CC(=C3[P@]2C(C)(C)C)C4=C(C=CC=C4OC)OC)C(C)C |
Computed by PubChem (NCBI)