cas: 1903830-44-3 — see every product listed under this CAS number, including other names
rel-(3R,4S)-4-Fluorotetrahydrofuran-3-amine hydrochloride 99% (CAS 1903830-44-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A2661908-100mg |
| cas | 1903830-44-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 681.88 Pln | |
| Ambeed | 250mg | 1171.38 Pln | |
| Ambeed | 1g | 2918.00 Pln | |
| Ambeed | 5g | 9476.19 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A2661908 |
(3S,4R)-4-fluorooxolan-3-amine;hydrochloride (CAS 1903830-44-3) is a chemical compound with the molecular formula C4H9ClFNO and a molecular weight of 141.57 g/mol. IUPAC name: (3S,4R)-4-fluorooxolan-3-amine;hydrochloride. InChIKey: ZDRLKYGLYRTMMM-MMALYQPHSA-N.
| Molecular formula | C4H9ClFNO |
|---|---|
| Molecular weight | 141.57 g/mol |
| IUPAC name | (3S,4R)-4-fluorooxolan-3-amine;hydrochloride |
| InChIKey | ZDRLKYGLYRTMMM-MMALYQPHSA-N |
| SMILES | C1[C@@H]([C@H](CO1)F)N.Cl |
Computed by PubChem (NCBI)