cas: 194151-77-4 — see every product listed under this CAS number, including other names
rel-(3aR,5s,6aS)-tert-Butyl 5-hydroxyhexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate 95% (CAS 194151-77-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A415075-100mg |
| cas | 194151-77-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 859.88 Pln | |
| Ambeed | 250mg | 1215.88 Pln | |
| Ambeed | 1g | 3518.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A415075 |
Tert-butyl (3aR,6aS)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (CAS 194151-77-4) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl (3aR,6aS)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate. InChIKey: DIDQRACXWWEPDZ-ULKQDVFKSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl (3aR,6aS)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| InChIKey | DIDQRACXWWEPDZ-ULKQDVFKSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC(C[C@H]2C1)O |
Computed by PubChem (NCBI)