CAS 1884222-74-5 appears in our catalog under these names: SBP–7455, sbp-7455/ 99.03% (existing batch purity), N4-Cyclopropyl-N2-(3,4-dimethoxyphenyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine, 98%, 98%, SBP-7455, 98.01%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 100 mg, 5 mg.
4-N-cyclopropyl-2-N-(3,4-dimethoxyphenyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine (CAS 1884222-74-5) is a chemical compound with the molecular formula C16H17F3N4O2 and a molecular weight of 354.33 g/mol. IUPAC name: 4-N-cyclopropyl-2-N-(3,4-dimethoxyphenyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine. InChIKey: BQROJYIEHOOQBY-UHFFFAOYSA-N.
| Molecular formula | C16H17F3N4O2 |
|---|---|
| Molecular weight | 354.33 g/mol |
| IUPAC name | 4-N-cyclopropyl-2-N-(3,4-dimethoxyphenyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| InChIKey | BQROJYIEHOOQBY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)NC2=NC=C(C(=N2)NC3CC3)C(F)(F)F)OC |
Computed by PubChem (NCBI)