cas: 943858-70-6 — see every product listed under this CAS number, including other names
succimimidyl-4-azidobutyrate, 98%, 98% (CAS 943858-70-6) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114UG5-10mg |
| cas | 943858-70-6 |
| size | 10mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 194.00 Pln | |
| Chemat | 25mg | 294.80 Pln | |
| Chemat | 100mg | 438.80 Pln | |
| Chemat | 250mg | 717.20 Pln | |
| Chemat | 1g | 2094.80 Pln | |
| Chemat | 5g | 5920.40 Pln | |
| Chemat | 10g | 6698.00 Pln | |
| Chemat | 25g | 13346.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 4-azidobutanoate (CAS 943858-70-6) is a chemical compound with the molecular formula C8H10N4O4 and a molecular weight of 226.19 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 4-azidobutanoate. InChIKey: YYULROINNKAMIB-UHFFFAOYSA-N.
| Molecular formula | C8H10N4O4 |
|---|---|
| Molecular weight | 226.19 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 4-azidobutanoate |
| InChIKey | YYULROINNKAMIB-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCN=[N+]=[N-] |
Computed by PubChem (NCBI)