cas: 886362-17-0 — see every product listed under this CAS number, including other names
tert-Butyl ((1-(2-aminoethyl)cyclohexyl)methyl)carbamate, 98% (CAS 886362-17-0) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 1g, 100mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A934283-25mg |
| cas | 886362-17-0 |
| size | 25mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25mg | 1931.86 Pln | |
| AmBeed | 1g | 4724.65 Pln | |
| AmBeed | 100mg | 2322.46 Pln | |
| AmBeed | 5g | 14033.95 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl N-[[1-(2-aminoethyl)cyclohexyl]methyl]carbamate (CAS 886362-17-0) is a chemical compound with the molecular formula C14H28N2O2 and a molecular weight of 256.38 g/mol. IUPAC name: tert-butyl N-[[1-(2-aminoethyl)cyclohexyl]methyl]carbamate. InChIKey: GZBKNFMNMFIGNU-UHFFFAOYSA-N.
| Molecular formula | C14H28N2O2 |
|---|---|
| Molecular weight | 256.38 g/mol |
| IUPAC name | tert-butyl N-[[1-(2-aminoethyl)cyclohexyl]methyl]carbamate |
| InChIKey | GZBKNFMNMFIGNU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1(CCCCC1)CCN |
Computed by PubChem (NCBI)