CAS 1016971-66-6 appears in our catalog under these names: (1R,2R)-Boc-1,2-diaminocyclopentane, (1R,2R)–trans–N–Boc–1,2–cyclopentanediamine, (1R,2R)-Boc-1,2-diaminocyclopentane, 97%, tert-Butyl ((1R,2R)-2-aminocyclopentyl)carbamate, 98%. Offered by: TRC, GLPBio, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 50mg, 100mg, 5g.
Tert-butyl N-[(1R,2R)-2-aminocyclopentyl]carbamate (CAS 1016971-66-6) is a chemical compound with the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. IUPAC name: tert-butyl N-[(1R,2R)-2-aminocyclopentyl]carbamate. InChIKey: PAXDIBGWURAVIH-HTQZYQBOSA-N.
| Molecular formula | C10H20N2O2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | tert-butyl N-[(1R,2R)-2-aminocyclopentyl]carbamate |
| InChIKey | PAXDIBGWURAVIH-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@H]1N |
Computed by PubChem (NCBI)