cas: 1788036-23-6 — see every product listed under this CAS number, including other names
tert-Butyl ((1R,3R)-3-aminocyclohexyl)carbamate, 98%, 98% (CAS 1788036-23-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1137BO-50mg |
| cas | 1788036-23-6 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 554.00 Pln | |
| Chemat | 100mg | 899.60 Pln | |
| Chemat | 250mg | 1398.80 Pln | |
| Chemat | 500mg | 2382.80 Pln | |
| Chemat | 1g | 3405.20 Pln | |
| Chemat | 5g | 13989.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(1R,3R)-3-aminocyclohexyl]carbamate (CAS 1788036-23-6) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[(1R,3R)-3-aminocyclohexyl]carbamate. InChIKey: OBSACSBMTRJNPH-RKDXNWHRSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[(1R,3R)-3-aminocyclohexyl]carbamate |
| InChIKey | OBSACSBMTRJNPH-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@H](C1)N |
Computed by PubChem (NCBI)