cas: 586961-34-4 — see every product listed under this CAS number, including other names
tert-Butyl ((1S,2S)-2-aminocyclopentyl)carbamate, 97% (CAS 586961-34-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210412-100MG |
| cas | 586961-34-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 763.29 Pln | |
| Fluorochem | 500mg | 1356.83 Pln | |
| Fluorochem | 1g | 1997.23 Pln | |
| Fluorochem | 5g | 8088.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[(1S,2S)-2-aminocyclopentyl]carbamate (CAS 586961-34-4) is a chemical compound with the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. IUPAC name: tert-butyl N-[(1S,2S)-2-aminocyclopentyl]carbamate. InChIKey: PAXDIBGWURAVIH-YUMQZZPRSA-N.
| Molecular formula | C10H20N2O2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | tert-butyl N-[(1S,2S)-2-aminocyclopentyl]carbamate |
| InChIKey | PAXDIBGWURAVIH-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC[C@@H]1N |
Computed by PubChem (NCBI)