cas: 145166-06-9 — see every product listed under this CAS number, including other names
tert-Butyl ((1S,2S)-2-hydroxycyclohexyl)carbamate, 97% (CAS 145166-06-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 1g, 10g, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A376843-25g |
| cas | 145166-06-9 |
| size | 25g |
| availability | USA Stock: 15.25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 2589.37 Pln | |
| AmBeed | 5g | 648.09 Pln | |
| AmBeed | 1g | 189.78 Pln | |
| AmBeed | 10g | 1101.18 Pln | |
| AmBeed | 250mg | 101.25 Pln | |
| Fluorochem | 1g | 148.92 Pln | |
| Fluorochem | 5g | 310.33 Pln | |
| Fluorochem | 10g | 560.24 Pln | |
| Fluorochem | 25g | 1309.97 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl N-[(1S,2S)-2-hydroxycyclohexyl]carbamate (CAS 145166-06-9) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl N-[(1S,2S)-2-hydroxycyclohexyl]carbamate. InChIKey: XVROWZPERFUOCE-IUCAKERBSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl N-[(1S,2S)-2-hydroxycyclohexyl]carbamate |
| InChIKey | XVROWZPERFUOCE-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCC[C@@H]1O |
Computed by PubChem (NCBI)