CAS 145166-06-9 appears in our catalog under these names: tert-Butyl ((1S,2S)-2-hydroxycyclohexyl)carbamate, 97%, (1S,2S)–trans–N–Boc–2–aminocyclohexanol, tert-Butyl ((1S,2S)-2-hydroxycyclohexyl)carbamate 98%. Offered by: AmBeed, GLPBio, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 250mg, 100g.
Tert-butyl N-[(1S,2S)-2-hydroxycyclohexyl]carbamate (CAS 145166-06-9) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl N-[(1S,2S)-2-hydroxycyclohexyl]carbamate. InChIKey: XVROWZPERFUOCE-IUCAKERBSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl N-[(1S,2S)-2-hydroxycyclohexyl]carbamate |
| InChIKey | XVROWZPERFUOCE-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCC[C@@H]1O |
Computed by PubChem (NCBI)