cas: 1788036-28-1 — see every product listed under this CAS number, including other names
tert-Butyl ((1S,3S)-3-aminocyclohexyl)carbamate, 97%, 97% (CAS 1788036-28-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1137BJ-50mg |
| cas | 1788036-28-1 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 458.00 Pln | |
| Chemat | 100mg | 736.40 Pln | |
| Chemat | 250mg | 1307.60 Pln | |
| Chemat | 1g | 3414.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(1S,3S)-3-aminocyclohexyl]carbamate (CAS 1788036-28-1) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[(1S,3S)-3-aminocyclohexyl]carbamate. InChIKey: OBSACSBMTRJNPH-IUCAKERBSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[(1S,3S)-3-aminocyclohexyl]carbamate |
| InChIKey | OBSACSBMTRJNPH-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC[C@@H](C1)N |
Computed by PubChem (NCBI)