cas: 1172623-99-2 — see every product listed under this CAS number, including other names
tert-Butyl ((2R,3S)-2-(2,5-difluorophenyl)-5-hydroxytetrahydro-2H-pyran-3-yl)carbamate, 98% (CAS 1172623-99-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F054440-100MG |
| cas | 1172623-99-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1190.22 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[(2R,3S)-2-(2,5-difluorophenyl)-5-hydroxyoxan-3-yl]carbamate (CAS 1172623-99-2) is a chemical compound with the molecular formula C16H21F2NO4 and a molecular weight of 329.34 g/mol. IUPAC name: tert-butyl N-[(2R,3S)-2-(2,5-difluorophenyl)-5-hydroxyoxan-3-yl]carbamate. InChIKey: RYDSJJXCDQFTKF-INPHSSGZSA-N.
| Molecular formula | C16H21F2NO4 |
|---|---|
| Molecular weight | 329.34 g/mol |
| IUPAC name | tert-butyl N-[(2R,3S)-2-(2,5-difluorophenyl)-5-hydroxyoxan-3-yl]carbamate |
| InChIKey | RYDSJJXCDQFTKF-INPHSSGZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC(CO[C@@H]1C2=C(C=CC(=C2)F)F)O |
Computed by PubChem (NCBI)